Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Ethylenediaminetetraacetic acid disodium magnesium salt hydrate
CAS: 194491-32-2 Molecular Formula: C10H12MgN2Na2O8 Molecular Weight (g/mol): 358.50 MDL Number: MFCD00078217 InChI Key: AWNVVAMWLMUZOZ-UHFFFAOYSA-J Synonym: unii-ndt563s5vz,edta magnesium disodium,magnesium disodium edta,ndt563s5vz,magnesium disodium ethylenediaminetetraacetate,edta magnesium disodium salt hydrate,ethylenediaminetetraacetic acid magnesium disodium salt,ethylenediaminetetraacetic acid disodium magnesium salt,ethylenediaminetetraacetic acid disodium magnesium salt hydrate,magnesium sodium ethylenediaminetetraacetate PubChem CID: 161064 IUPAC Name: magnesium;disodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate SMILES: [Na+].[Na+].[Mg++].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 161064 |
|---|---|
| CAS | 194491-32-2 |
| Molecular Weight (g/mol) | 358.50 |
| MDL Number | MFCD00078217 |
| SMILES | [Na+].[Na+].[Mg++].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | unii-ndt563s5vz,edta magnesium disodium,magnesium disodium edta,ndt563s5vz,magnesium disodium ethylenediaminetetraacetate,edta magnesium disodium salt hydrate,ethylenediaminetetraacetic acid magnesium disodium salt,ethylenediaminetetraacetic acid disodium magnesium salt,ethylenediaminetetraacetic acid disodium magnesium salt hydrate,magnesium sodium ethylenediaminetetraacetate |
| IUPAC Name | magnesium;disodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate |
| InChI Key | AWNVVAMWLMUZOZ-UHFFFAOYSA-J |
| Molecular Formula | C10H12MgN2Na2O8 |
Di-n-butylamine, 99%
CAS: 111-92-2 MDL Number: MFCD00009429 InChI Key: JQVDAXLFBXTEQA-UHFFFAOYSA-N Synonym: dibutylamine,di-n-butylamine,1-butanamine, n-butyl,n-butyl-1-butanamine,dibutilamina,n-dibutylamine,di-n-butyl amine,dibutyl amine,di-normal-butylamine,dibutyl-amine PubChem CID: 8148 IUPAC Name: N-butylbutan-1-amine SMILES: CCCCNCCCC
| PubChem CID | 8148 |
|---|---|
| CAS | 111-92-2 |
| MDL Number | MFCD00009429 |
| SMILES | CCCCNCCCC |
| Synonym | dibutylamine,di-n-butylamine,1-butanamine, n-butyl,n-butyl-1-butanamine,dibutilamina,n-dibutylamine,di-n-butyl amine,dibutyl amine,di-normal-butylamine,dibutyl-amine |
| IUPAC Name | N-butylbutan-1-amine |
| InChI Key | JQVDAXLFBXTEQA-UHFFFAOYSA-N |
Sodium methoxide, ca 25% w/w in methanol
CAS: 124-41-4 Molecular Formula: CH3NaO Molecular Weight (g/mol): 54.024 MDL Number: MFCD00012179 InChI Key: WQDUMFSSJAZKTM-UHFFFAOYSA-N Synonym: sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 PubChem CID: 10942334 IUPAC Name: sodium;methanolate SMILES: C[O-].[Na+]
| PubChem CID | 10942334 |
|---|---|
| CAS | 124-41-4 |
| Molecular Weight (g/mol) | 54.024 |
| MDL Number | MFCD00012179 |
| SMILES | C[O-].[Na+] |
| Synonym | sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 |
| IUPAC Name | sodium;methanolate |
| InChI Key | WQDUMFSSJAZKTM-UHFFFAOYSA-N |
| Molecular Formula | CH3NaO |
Toluene-2,4-diisocyanate, tech. 80%, remainder 2,6-diisocyanate
CAS: 584-84-9 Molecular Formula: C9H6N2O2 Molecular Weight (g/mol): 174.159 MDL Number: MFCD00002011 InChI Key: DVKJHBMWWAPEIU-UHFFFAOYSA-N Synonym: 2,4-toluene diisocyanate,2,4-diisocyanatotoluene,tolylene-2,4-diisocyanate,toluene-2,4-diisocyanate,2,4-tolylene diisocyanate,toluene 2,4-diisocyanate,4-methyl-m-phenylene diisocyanate,tolylene diisocyanate,2,4-tdi,toluylene-2,4-diisocyanate PubChem CID: 11443 ChEBI: CHEBI:53556 IUPAC Name: 2,4-diisocyanato-1-methylbenzene SMILES: CC1=C(C=C(C=C1)N=C=O)N=C=O
| PubChem CID | 11443 |
|---|---|
| CAS | 584-84-9 |
| Molecular Weight (g/mol) | 174.159 |
| ChEBI | CHEBI:53556 |
| MDL Number | MFCD00002011 |
| SMILES | CC1=C(C=C(C=C1)N=C=O)N=C=O |
| Synonym | 2,4-toluene diisocyanate,2,4-diisocyanatotoluene,tolylene-2,4-diisocyanate,toluene-2,4-diisocyanate,2,4-tolylene diisocyanate,toluene 2,4-diisocyanate,4-methyl-m-phenylene diisocyanate,tolylene diisocyanate,2,4-tdi,toluylene-2,4-diisocyanate |
| IUPAC Name | 2,4-diisocyanato-1-methylbenzene |
| InChI Key | DVKJHBMWWAPEIU-UHFFFAOYSA-N |
| Molecular Formula | C9H6N2O2 |
2,2,2-Trichloroethanol, 99%
CAS: 115-20-8 Molecular Formula: C2H3Cl3O Molecular Weight (g/mol): 149.395 MDL Number: MFCD00004677 InChI Key: KPWDGTGXUYRARH-UHFFFAOYSA-N Synonym: trichloroethanol,trichlorethanol,trichloroethyl alcohol,ethanol, 2,2,2-trichloro,2,2,2-trichloro-1-ethanol,hydroxymethyl trichloromethane,2,2,2-trichloroethyl alcohol,2,2,2-trichloroethan-1-ol,unii-aw835aj62n,beta-trichloroethanol PubChem CID: 8259 ChEBI: CHEBI:28094 IUPAC Name: 2,2,2-trichloroethanol SMILES: C(C(Cl)(Cl)Cl)O
| PubChem CID | 8259 |
|---|---|
| CAS | 115-20-8 |
| Molecular Weight (g/mol) | 149.395 |
| ChEBI | CHEBI:28094 |
| MDL Number | MFCD00004677 |
| SMILES | C(C(Cl)(Cl)Cl)O |
| Synonym | trichloroethanol,trichlorethanol,trichloroethyl alcohol,ethanol, 2,2,2-trichloro,2,2,2-trichloro-1-ethanol,hydroxymethyl trichloromethane,2,2,2-trichloroethyl alcohol,2,2,2-trichloroethan-1-ol,unii-aw835aj62n,beta-trichloroethanol |
| IUPAC Name | 2,2,2-trichloroethanol |
| InChI Key | KPWDGTGXUYRARH-UHFFFAOYSA-N |
| Molecular Formula | C2H3Cl3O |
Thermo Scientific Chemicals D-Glucosamine hydrochloride, 98+%
CAS: 66-84-2 Molecular Formula: C6H13NO5·HCl MDL Number: MFCD00067674
| CAS | 66-84-2 |
|---|---|
| MDL Number | MFCD00067674 |
| Molecular Formula | C6H13NO5·HCl |
Cyclopentane, HPLC Grade
CAS: 287-92-3 Molecular Formula: C5H10 Molecular Weight (g/mol): 70.135 MDL Number: MFCD00001356 InChI Key: RGSFGYAAUTVSQA-UHFFFAOYSA-N Synonym: pentamethylene,ciclopentano,cyclopentan,zyklopentan,unii-t86pb90rnu,hsdb 62,t86pb90rnu,cyclopentanes,cyclopentyl group,hydrocarbons, cyclic c5 and c6 PubChem CID: 9253 ChEBI: CHEBI:23492 IUPAC Name: cyclopentane SMILES: C1CCCC1
| PubChem CID | 9253 |
|---|---|
| CAS | 287-92-3 |
| Molecular Weight (g/mol) | 70.135 |
| ChEBI | CHEBI:23492 |
| MDL Number | MFCD00001356 |
| SMILES | C1CCCC1 |
| Synonym | pentamethylene,ciclopentano,cyclopentan,zyklopentan,unii-t86pb90rnu,hsdb 62,t86pb90rnu,cyclopentanes,cyclopentyl group,hydrocarbons, cyclic c5 and c6 |
| IUPAC Name | cyclopentane |
| InChI Key | RGSFGYAAUTVSQA-UHFFFAOYSA-N |
| Molecular Formula | C5H10 |
Tributyl phosphate, 99+%, Thermo Scientific Chemicals
CAS: 126-73-8 Molecular Formula: C12H27O4P Molecular Weight (g/mol): 266.32 MDL Number: MFCD00009436 InChI Key: STCOOQWBFONSKY-UHFFFAOYSA-N Synonym: tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de PubChem CID: 31357 ChEBI: CHEBI:35019 IUPAC Name: tributyl phosphate SMILES: CCCCOP(=O)(OCCCC)OCCCC
| PubChem CID | 31357 |
|---|---|
| CAS | 126-73-8 |
| Molecular Weight (g/mol) | 266.32 |
| ChEBI | CHEBI:35019 |
| MDL Number | MFCD00009436 |
| SMILES | CCCCOP(=O)(OCCCC)OCCCC |
| Synonym | tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de |
| IUPAC Name | tributyl phosphate |
| InChI Key | STCOOQWBFONSKY-UHFFFAOYSA-N |
| Molecular Formula | C12H27O4P |
N,N-Dimethylacetamide, 99%
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
Ethyl pyruvate, 98%
CAS: 617-35-6 Molecular Formula: C5H8O3 Molecular Weight (g/mol): 116.116 MDL Number: MFCD00009123 InChI Key: XXRCUYVCPSWGCC-UHFFFAOYSA-N Synonym: ethyl pyruvate,ethyl 2-oxopropionate,pyruvic acid, ethyl ester,propanoic acid, 2-oxo-, ethyl ester,pyruvic acid ethyl ester,ethyl pyroracemate,ethyl acetylformate,2-oxo-propionic acid ethyl ester,ethyl pyruvate natural,ethyl alpha-ketopropionate PubChem CID: 12041 IUPAC Name: ethyl 2-oxopropanoate SMILES: CCOC(=O)C(=O)C
| PubChem CID | 12041 |
|---|---|
| CAS | 617-35-6 |
| Molecular Weight (g/mol) | 116.116 |
| MDL Number | MFCD00009123 |
| SMILES | CCOC(=O)C(=O)C |
| Synonym | ethyl pyruvate,ethyl 2-oxopropionate,pyruvic acid, ethyl ester,propanoic acid, 2-oxo-, ethyl ester,pyruvic acid ethyl ester,ethyl pyroracemate,ethyl acetylformate,2-oxo-propionic acid ethyl ester,ethyl pyruvate natural,ethyl alpha-ketopropionate |
| IUPAC Name | ethyl 2-oxopropanoate |
| InChI Key | XXRCUYVCPSWGCC-UHFFFAOYSA-N |
| Molecular Formula | C5H8O3 |
| Linear Formula | [CH3(CH2)3]4NOH |
|---|---|
| Molecular Weight (g/mol) | 259.48 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Density | 0.9100g/mL |
| PubChem CID | 2723671 |
| Name Note | 40 wt.% solution in methanol |
| Percent Purity | ≥40% |
| Fieser | 05,645; 11,500 |
| Formula Weight | 259.46 |
| Melting Point | -98.0°C |
| Boiling Point | 65.0°C |
| Color | Colorless to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Tetrabutylammonium hydroxide |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove conta |
| MDL Number | MFCD00009425 |
| Health Hazard 2 | GHS H Statement Toxic in contact with skin. Toxic if swallowed. Causes severe skin burns and eye damage. Toxic if inhaled. Causes damage to organs. Highly flammable liquid and vapor. |
| Solubility Information | Solubility in water: soluble |
| Packaging | Glass bottle |
| Flash Point | 12°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium;hydroxide |
| Beilstein | 04, II, 634 |
| Molecular Formula | C16H37NO |
| EINECS Number | 218-147-6 |
| Specific Gravity | 0.91 |
L(-)-Glutathione, oxidized hydrate, 95%
CAS: 27025-41-8 Molecular Formula: C20H32N6O12S2 Molecular Weight (g/mol): 612.63 MDL Number: MFCD00150701 InChI Key: YPZRWBKMTBYPTK-IOKZUGQQNA-N Synonym: oxiglutatione,glutathione disulfide,gssg,oxidized glutathione,glutathione disulphide,glutathione-ssg,l-glutathione oxidized,oxigluthione,glutathone disulfide,glutathione oxidized PubChem CID: 65359 ChEBI: CHEBI:17858 IUPAC Name: (2S)-2-amino-5-[[(2R)-3-[[(2R)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-(carboxymethylamino)-3-oxopropyl]disulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid SMILES: N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)C(=O)NCC(O)=O)C(O)=O
| PubChem CID | 65359 |
|---|---|
| CAS | 27025-41-8 |
| Molecular Weight (g/mol) | 612.63 |
| ChEBI | CHEBI:17858 |
| MDL Number | MFCD00150701 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)C(=O)NCC(O)=O)C(O)=O |
| Synonym | oxiglutatione,glutathione disulfide,gssg,oxidized glutathione,glutathione disulphide,glutathione-ssg,l-glutathione oxidized,oxigluthione,glutathone disulfide,glutathione oxidized |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-3-[[(2R)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-(carboxymethylamino)-3-oxopropyl]disulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| InChI Key | YPZRWBKMTBYPTK-IOKZUGQQNA-N |
| Molecular Formula | C20H32N6O12S2 |
Tripotassium citrate monohydrate, 99+%
CAS: 6100-05-6 Molecular Formula: C6H7K3O8 Molecular Weight (g/mol): 324.41 MDL Number: MFCD00150442 InChI Key: PJAHUDTUZRZBKM-UHFFFAOYSA-K Synonym: potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate PubChem CID: 2735208 ChEBI: CHEBI:64746 IUPAC Name: tripotassium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+]
| PubChem CID | 2735208 |
|---|---|
| CAS | 6100-05-6 |
| Molecular Weight (g/mol) | 324.41 |
| ChEBI | CHEBI:64746 |
| MDL Number | MFCD00150442 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+] |
| Synonym | potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate |
| IUPAC Name | tripotassium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate |
| InChI Key | PJAHUDTUZRZBKM-UHFFFAOYSA-K |
| Molecular Formula | C6H7K3O8 |
Iodoethane (stabilized with Copper chip) 99.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 75-03-6 Molecular Formula: C2H5I Molecular Weight (g/mol): 155.966 MDL Number: MFCD00001091 InChI Key: HVTICUPFWKNHNG-UHFFFAOYSA-N Synonym: ethyl iodide,ethane, iodo,monoiodoethane,hydriodic ether,ethyliodide,jodethan czech,ethyljodid,jodethan,iodo-ethane,ethyljodid czech PubChem CID: 6340 ChEBI: CHEBI:42487 IUPAC Name: iodoethane SMILES: CCI
| PubChem CID | 6340 |
|---|---|
| CAS | 75-03-6 |
| Molecular Weight (g/mol) | 155.966 |
| ChEBI | CHEBI:42487 |
| MDL Number | MFCD00001091 |
| SMILES | CCI |
| Synonym | ethyl iodide,ethane, iodo,monoiodoethane,hydriodic ether,ethyliodide,jodethan czech,ethyljodid,jodethan,iodo-ethane,ethyljodid czech |
| IUPAC Name | iodoethane |
| InChI Key | HVTICUPFWKNHNG-UHFFFAOYSA-N |
| Molecular Formula | C2H5I |
Calcium D-gluconate gel, 2.5% w/w aq. soln.
CAS: 299-28-5 Molecular Formula: C12H22CaO14 Molecular Weight (g/mol): 430.372 MDL Number: MFCD00064209 InChI Key: NEEHYRZPVYRGPP-IYEMJOQQSA-L Synonym: calcium gluconate,calcium d-gluconate,calciofon,calglucon,glucobiogen,ebucin,calcicol,calcipur,calglucol,dragocal PubChem CID: 9290 IUPAC Name: calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2]
| PubChem CID | 9290 |
|---|---|
| CAS | 299-28-5 |
| Molecular Weight (g/mol) | 430.372 |
| MDL Number | MFCD00064209 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
| Synonym | calcium gluconate,calcium d-gluconate,calciofon,calglucon,glucobiogen,ebucin,calcicol,calcipur,calglucol,dragocal |
| IUPAC Name | calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChI Key | NEEHYRZPVYRGPP-IYEMJOQQSA-L |
| Molecular Formula | C12H22CaO14 |